CAS 1355247-94-7
:3-(4-Chlorophenyl)-2-pyridinecarbonitrile
Description:
3-(4-Chlorophenyl)-2-pyridinecarbonitrile is an organic compound characterized by its pyridine and nitrile functional groups, along with a chlorophenyl substituent. The presence of the pyridine ring contributes to its aromaticity and potential for various chemical interactions, while the nitrile group (-C≡N) imparts notable polarity and reactivity, making it a useful building block in organic synthesis. The chlorophenyl moiety enhances the compound's lipophilicity and may influence its biological activity, potentially making it a candidate for pharmaceutical applications. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties, such as reactivity and stability, can be influenced by the electron-withdrawing nature of the cyano group and the electronegative chlorine atom. Overall, 3-(4-Chlorophenyl)-2-pyridinecarbonitrile is of interest in medicinal chemistry and material science due to its structural features and potential applications in drug development and synthesis.
Formula:C12H7ClN2
InChI:InChI=1S/C12H7ClN2/c13-10-5-3-9(4-6-10)11-2-1-7-15-12(11)8-14/h1-7H
InChI key:InChIKey=GVWASMAZWFRZLO-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=CC=N1)C2=CC=C(Cl)C=C2
Synonyms:- 2-Pyridinecarbonitrile, 3-(4-chlorophenyl)-
- 3-(4-Chlorophenyl)-2-pyridinecarbonitrile
- 3-(4-Chlorophenyl)pyridine-2-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.