CAS 1355247-96-9

2′-Acetyl-3-chloro[1,1′-biphenyl]-4-carboxylic acid

Description:

2′-Acetyl-3-chloro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an acetyl group at the 2' position and a carboxylic acid group at the 4-position contributes to its reactivity and potential applications in organic synthesis. The chlorine atom at the 3-position introduces electronegativity, influencing the compound's chemical behavior and polarity. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic biphenyl framework, while the carboxylic acid group can engage in hydrogen bonding, enhancing solubility in polar solvents. Its unique structure may also impart specific biological activities, making it of interest in pharmaceutical research. The compound's CAS number, 1355247-96-9, allows for precise identification in chemical databases, facilitating further studies on its properties, synthesis, and potential applications in various fields, including materials science and medicinal chemistry.

Formula: C₁₅H₁₁ClO₃

InChI: InChI=1S/C15H11ClO3/c1-9(17)11-4-2-3-5-12(11)10-6-7-13(15(18)19)14(16)8-10/h2-8H,1H3,(H,18,19)

InChI key: InChIKey=OJORRYBFKFJYGU-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(C=CC=C1)C2=CC(Cl)=C(C(O)=O)C=C2

Synonyms:

• 2′-Acetyl-3-chloro[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 2′-acetyl-3-chloro-