CymitQuimica logo

CAS 1355248-00-8

:

2-Bromo-6-fluoro-N-(1-methylethyl)benzenemethanamine

Description:
2-Bromo-6-fluoro-N-(1-methylethyl)benzenemethanamine is an organic compound characterized by the presence of a bromine atom and a fluorine atom on a benzene ring, along with an amine functional group. The structure features a branched alkyl group, specifically isopropyl (1-methylethyl), attached to the nitrogen atom of the amine. This compound is likely to exhibit properties typical of aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of halogen substituents, which can influence its electrophilic and nucleophilic behavior. The bromine and fluorine substituents can also affect the compound's electronic properties, potentially enhancing its reactivity in various chemical reactions. Additionally, the presence of the amine group may impart basic characteristics, allowing it to participate in acid-base reactions. Overall, this compound may have applications in pharmaceuticals or materials science, although specific uses would depend on further research into its biological activity and chemical behavior.
Formula:C10H13BrFN
InChI:InChI=1S/C10H13BrFN/c1-7(2)13-6-8-9(11)4-3-5-10(8)12/h3-5,7,13H,6H2,1-2H3
InChI key:InChIKey=MWVYNXRZXJLGMN-UHFFFAOYSA-N
SMILES:C(NC(C)C)C1=C(Br)C=CC=C1F
Synonyms:
  • 2-Bromo-6-fluoro-N-(1-methylethyl)benzenemethanamine
  • Benzenemethanamine, 2-bromo-6-fluoro-N-(1-methylethyl)-
  • N-Isopropyl 2-broMo-6-fluorobenzylaMine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.