CAS 1355248-02-0

[1,1′-Biphenyl]-2-amine, 3′,5′-dichloro-, hydrochloride (1:1)

Description:

[1,1′-Biphenyl]-2-amine, 3′,5′-dichloro-, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure with an amino group and dichloro substituents. The presence of the amino group indicates that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The dichloro groups at the 3′ and 5′ positions of the biphenyl ring suggest that the compound may exhibit specific electronic properties, potentially influencing its reactivity and interaction with biological systems. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its structural features that could confer specific biological activities. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential toxicity or environmental impact.

Formula: C₁₂H₉Cl₂N·ClH

InChI: InChI=1S/C12H9Cl2N.ClH/c13-9-5-8(6-10(14)7-9)11-3-1-2-4-12(11)15;/h1-7H,15H2;1H

InChI key: InChIKey=OHMOOTIOCHDIIC-UHFFFAOYSA-N

SMILES: NC1=C(C=CC=C1)C2=CC(Cl)=CC(Cl)=C2.Cl

Synonyms:

• [1,1′-Biphenyl]-2-amine, 3′,5′-dichloro-, hydrochloride (1:1)