CAS 1355248-05-3

1-(4-Formylphenyl)-3-azetidinecarboxylic acid

Description:

1-(4-Formylphenyl)-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes an azetidine ring and a formylphenyl group. The azetidine ring is a four-membered saturated heterocycle containing one nitrogen atom, contributing to the compound's potential biological activity. The presence of the formyl group (–CHO) on the phenyl ring indicates that this compound can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the carboxylic acid functional group (–COOH) enhances its solubility in polar solvents and allows for potential interactions with biological systems, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may exhibit interesting properties, including potential antimicrobial or anti-inflammatory activities, although specific biological data would be required to confirm such effects. Overall, 1-(4-Formylphenyl)-3-azetidinecarboxylic acid represents a versatile scaffold for further chemical modifications and applications in drug development.

Formula: C₁₁H₁₁NO₃

InChI: InChI=1S/C11H11NO3/c13-7-8-1-3-10(4-2-8)12-5-9(6-12)11(14)15/h1-4,7,9H,5-6H2,(H,14,15)

InChI key: InChIKey=JBVARJKZZNPSDV-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CN(C1)C2=CC=C(C=O)C=C2

Synonyms:

• 1-(4-Formylphenyl)-3-azetidinecarboxylic acid
• 3-Azetidinecarboxylic acid, 1-(4-formylphenyl)-

1-(4-Formylphenyl)azetidine-3-carboxylic acid

CAS: 1355248-05-3

Formula: C₁₁H₁₁NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.2099

Ref: IN-DA007LDK

1-(4-Formylphenyl)azetidine-3-carboxylic acid

CAS: 1355248-05-3

1-(4-Formylphenyl)azetidine-3-carboxylic acid

Purity: 98%

Molecular weight: 205.21g/mol

Ref: 54-OR1068078

1-(4-Formylphenyl)azetidine-3-carboxylic acid

CAS: 1355248-05-3

1-(4-Formylphenyl)azetidine-3-carboxylic acid is a chemical that belongs to the group of useful building blocks, research chemicals, and reagents. It is a high quality, versatile building block that can be used in the synthesis of complex compounds. 1-(4-Formylphenyl)azetidine-3-carboxylic acid can be used as a reaction component or intermediate for the synthesis of many different types of compounds. The CAS number for this product is 1355248-05-3.

Formula: C₁₁H₁₁NO₃

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 205.21 g/mol

Ref: 3D-FEC24805

1-(4-Formylphenyl)azetidine-3-carboxylic acid

CAS: 1355248-05-3

Formula: C₁₁H₁₁NO₃

Purity: 98%

Molecular weight: 205.213

Ref: 10-F236342