CAS 1355248-08-6
:3-Bromo-N-ethyl-2-fluorobenzenemethanamine
Description:
3-Bromo-N-ethyl-2-fluorobenzenemethanamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both bromine and fluorine atoms, as well as an ethyl group and an amine functional group. The presence of the bromine and fluorine substituents contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. The amine group indicates that the compound can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. Safety and handling considerations are essential, as halogenated compounds can pose environmental and health risks. Overall, 3-Bromo-N-ethyl-2-fluorobenzenemethanamine represents a versatile structure in organic synthesis and pharmaceutical research.
Formula:C9H11BrFN
InChI:InChI=1S/C9H11BrFN/c1-2-12-6-7-4-3-5-8(10)9(7)11/h3-5,12H,2,6H2,1H3
InChI key:InChIKey=DHRNGOKGZQVRLP-UHFFFAOYSA-N
SMILES:C(NCC)C1=C(F)C(Br)=CC=C1
Synonyms:- Benzenemethanamine, 3-bromo-N-ethyl-2-fluoro-
- 3-Bromo-N-ethyl-2-fluorobenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
