CAS 1355248-10-0
:2-Bromo-6-fluoro-N-propylbenzenemethanamine
Description:
2-Bromo-6-fluoro-N-propylbenzenemethanamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom at the 2-position and a fluorine atom at the 6-position. The presence of the N-propyl group indicates that there is a propyl chain attached to the nitrogen atom of the amine functional group. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The halogen substituents (bromine and fluorine) can also affect the compound's electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. Additionally, the presence of these halogens may impart unique characteristics such as increased lipophilicity or altered pharmacological properties, making it of interest in medicinal chemistry. Overall, 2-Bromo-6-fluoro-N-propylbenzenemethanamine is a complex molecule with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C10H13BrFN
InChI:InChI=1S/C10H13BrFN/c1-2-6-13-7-8-9(11)4-3-5-10(8)12/h3-5,13H,2,6-7H2,1H3
InChI key:InChIKey=FQCCVTXTBPNYAM-UHFFFAOYSA-N
SMILES:C(NCCC)C1=C(Br)C=CC=C1F
Synonyms:- 2-Bromo-6-fluoro-N-propylbenzenemethanamine
- Benzenemethanamine, 2-bromo-6-fluoro-N-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.