CAS 1355248-11-1

3-Bromo-2-fluoro-N-(1-methylethyl)benzenemethanamine

Description:

3-Bromo-2-fluoro-N-(1-methylethyl)benzenemethanamine is an organic compound characterized by the presence of a bromine atom and a fluorine atom on a benzene ring, along with an amine functional group. The structure features a branched alkyl substituent, specifically an isopropyl group, attached to the nitrogen atom of the amine. This compound is likely to exhibit properties typical of aromatic amines, such as moderate solubility in organic solvents and potential reactivity in electrophilic substitution reactions due to the electron-withdrawing effects of the halogen substituents. The presence of both bromine and fluorine can influence the compound's reactivity and stability, potentially making it useful in various synthetic applications or as an intermediate in pharmaceutical chemistry. Additionally, the specific arrangement of substituents may affect its biological activity, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₁₀H₁₃BrFN

InChI: InChI=1S/C10H13BrFN/c1-7(2)13-6-8-4-3-5-9(11)10(8)12/h3-5,7,13H,6H2,1-2H3

InChI key: InChIKey=SDJXPLGJENBBML-UHFFFAOYSA-N

SMILES: C(NC(C)C)C1=C(F)C(Br)=CC=C1

Synonyms:

• Benzenemethanamine, 3-bromo-2-fluoro-N-(1-methylethyl)-
• 3-Bromo-2-fluoro-N-(1-methylethyl)benzenemethanamine