CAS 1355248-12-2

Benzenamine, 2-(cyclopentylsulfonyl)-, hydrochloride (1:1)

Description:

Benzenamine, 2-(cyclopentylsulfonyl)-, hydrochloride (1:1), also known by its CAS number 1355248-12-2, is a chemical compound characterized by the presence of a benzenamine moiety substituted with a cyclopentylsulfonyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The sulfonyl group contributes to its potential reactivity, making it useful in various chemical applications, including pharmaceuticals and organic synthesis. The hydrochloride form enhances its stability and solubility, which is advantageous for biological activity and formulation in medicinal chemistry. Additionally, the compound may exhibit specific biological properties, making it a candidate for further research in drug development. As with many amines, it may also participate in hydrogen bonding, influencing its interactions in biological systems. Proper handling and storage conditions should be observed due to its chemical nature and potential reactivity.

Formula: C₁₁H₁₅NO₂S·ClH

InChI: InChI=1S/C11H15NO2S.ClH/c12-10-7-3-4-8-11(10)15(13,14)9-5-1-2-6-9;/h3-4,7-9H,1-2,5-6,12H2;1H

InChI key: InChIKey=QGMWCOGDPIKTDF-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(N)C=CC=C1)C2CCCC2.Cl

Synonyms:

• Benzenamine, 2-(cyclopentylsulfonyl)-, hydrochloride (1:1)