CAS 1355248-17-7

[1,1′-Biphenyl]-3-amine, 2′-chloro-5′-methoxy-, hydrochloride (1:1)

Description:

[1,1′-Biphenyl]-3-amine, 2′-chloro-5′-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an amino group at the 3-position and a chloro and methoxy substituent at the 2' and 5' positions, respectively, contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological studies and pharmaceutical formulations. The compound may exhibit various biological activities, making it of interest in drug development. Its molecular structure allows for potential interactions with biological targets, and the presence of halogen and methoxy groups can influence its pharmacokinetic properties. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with its use.

Formula: C₁₃H₁₂ClNO·ClH

InChI: InChI=1S/C13H12ClNO.ClH/c1-16-11-5-6-13(14)12(8-11)9-3-2-4-10(15)7-9;/h2-8H,15H2,1H3;1H

InChI key: InChIKey=AWRWBBZRCZKYHZ-UHFFFAOYSA-N

SMILES: ClC=1C(=CC(OC)=CC1)C2=CC(N)=CC=C2.Cl

Synonyms:

• [1,1′-Biphenyl]-3-amine, 2′-chloro-5′-methoxy-, hydrochloride (1:1)