CAS 1355248-18-8

4′-(Phenylmethoxy)[1,1′-biphenyl]-3-acetic acid

Description:

4′-(Phenylmethoxy)[1,1′-biphenyl]-3-acetic acid, identified by its CAS number 1355248-18-8, is a chemical compound characterized by its biphenyl structure substituted with a phenylmethoxy group and an acetic acid moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various interactions due to its multiple functional groups. The presence of the acetic acid group suggests it may exhibit acidic behavior, potentially participating in hydrogen bonding or acting as a weak acid in solution. The phenylmethoxy group can influence the compound's solubility and reactivity, making it relevant in organic synthesis and medicinal chemistry. Additionally, the biphenyl framework may contribute to its electronic properties, which can be significant in applications such as pharmaceuticals or materials science. Overall, this compound's unique structure may lead to interesting biological activities or chemical reactivity, warranting further investigation in various chemical contexts.

Formula: C₂₁H₁₈O₃

InChI: InChI=1S/C21H18O3/c22-21(23)14-17-7-4-8-19(13-17)18-9-11-20(12-10-18)24-15-16-5-2-1-3-6-16/h1-13H,14-15H2,(H,22,23)

InChI key: InChIKey=SGUBMDDENSLKJX-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=C(C=CC1)C2=CC=C(OCC3=CC=CC=C3)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-acetic acid, 4′-(phenylmethoxy)-
• 4′-(Phenylmethoxy)[1,1′-biphenyl]-3-acetic acid
• 3-(4-Benzyloxyphenyl)phenylacetic acid