CAS 1355248-19-9

3,3′-Dichloro-4′-methyl[1,1′-biphenyl]-4-carbonitrile

Description:

3,3′-Dichloro-4′-methyl[1,1′-biphenyl]-4-carbonitrile is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms at the 3 and 3' positions and a methyl group at the 4' position on one of the phenyl rings contributes to its unique chemical properties. Additionally, the carbonitrile functional group (-C≡N) at the 4 position of the biphenyl framework enhances its reactivity and polarity. This compound is typically used in various chemical applications, including as an intermediate in the synthesis of agrochemicals or pharmaceuticals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the substance. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can exhibit significant environmental and health impacts. Overall, 3,3′-Dichloro-4′-methyl[1,1′-biphenyl]-4-carbonitrile is a notable compound in organic chemistry with specific applications in industrial processes.

Formula: C₁₄H₉Cl₂N

InChI: InChI=1S/C14H9Cl2N/c1-9-2-3-10(6-13(9)15)11-4-5-12(8-17)14(16)7-11/h2-7H,1H3

InChI key: InChIKey=NKBQLZOQDSLIIB-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1C#N)C2=CC(Cl)=C(C)C=C2

Synonyms:

• 3,3′-Dichloro-4′-methyl[1,1′-biphenyl]-4-carbonitrile
• [1,1′-Biphenyl]-4-carbonitrile, 3,3′-dichloro-4′-methyl-
• 2-Chloro-4-(3-chloro-4-Methylphenyl)benzonitrile