CAS 1355248-24-6
:3-Chloro-4′-(methylthio)[1,1′-biphenyl]-4-carbonitrile
Description:
3-Chloro-4′-(methylthio)[1,1′-biphenyl]-4-carbonitrile is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 3-position and a methylthio group at the 4′-position introduces distinct chemical properties, including increased reactivity and potential for various substitution reactions. The carbonitrile functional group at the 4-position contributes to its polarity and can influence its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in agrochemicals or as an intermediate in organic synthesis. Additionally, the presence of halogen and sulfur atoms can enhance its electronic properties, which may be relevant in materials science. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds and nitriles. Overall, 3-Chloro-4′-(methylthio)[1,1′-biphenyl]-4-carbonitrile is a versatile compound with significant implications in various chemical fields.
Formula:C14H10ClNS
InChI:InChI=1S/C14H10ClNS/c1-17-13-6-4-10(5-7-13)11-2-3-12(9-16)14(15)8-11/h2-8H,1H3
InChI key:InChIKey=BHUUFGGLULTLCT-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1C#N)C2=CC=C(SC)C=C2
Synonyms:- [1,1′-Biphenyl]-4-carbonitrile, 3-chloro-4′-(methylthio)-
- 3-Chloro-4′-(methylthio)[1,1′-biphenyl]-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
