CAS 1355248-27-9
:3-Bromo-N-cyclohexyl-2-fluorobenzenemethanamine
Description:
3-Bromo-N-cyclohexyl-2-fluorobenzenemethanamine is an organic compound characterized by its complex structure, which includes a bromine atom, a fluorine atom, and a cyclohexyl group attached to a benzene ring. This compound features an amine functional group, which contributes to its potential reactivity and interactions in various chemical environments. The presence of both bromine and fluorine atoms suggests that it may exhibit unique electronic properties and could participate in halogen bonding or other intermolecular interactions. The cyclohexyl group adds to the steric bulk of the molecule, potentially influencing its solubility and reactivity. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in synthesizing other complex molecules. As with many halogenated amines, it is important to consider its safety and environmental impact, as halogenated compounds can exhibit varying degrees of toxicity and persistence in the environment.
Formula:C13H17BrFN
InChI:InChI=1S/C13H17BrFN/c14-12-8-4-5-10(13(12)15)9-16-11-6-2-1-3-7-11/h4-5,8,11,16H,1-3,6-7,9H2
InChI key:InChIKey=IFEOMKOVFBMILG-UHFFFAOYSA-N
SMILES:C(NC1CCCCC1)C2=C(F)C(Br)=CC=C2
Synonyms:- 3-Bromo-N-cyclohexyl-2-fluorobenzenemethanamine
- Benzenemethanamine, 3-bromo-N-cyclohexyl-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
