CymitQuimica logo

CAS 1355249-30-7

:

Ethyl 1-[(4-methoxyphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-3-carboxylate

Description:
Ethyl 1-[(4-methoxyphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-3-carboxylate is a complex organic compound characterized by its unique structural features, including a pyrazole ring, an ethyl ester functional group, and a boron-containing moiety. The presence of the 4-methoxyphenyl group suggests potential for aromatic interactions, while the tetramethyl-1,3,2-dioxaborolane unit indicates reactivity and potential applications in organoboron chemistry. This compound may exhibit interesting biological activities due to the pyrazole core, which is often associated with pharmacological properties. Its solubility and stability can be influenced by the ester and boron functionalities, making it a candidate for various synthetic applications, including drug development and materials science. Additionally, the compound's molecular structure may allow for specific interactions in biological systems, warranting further investigation into its potential therapeutic uses. Overall, this compound represents a fusion of organic and boron chemistry, with implications for both research and application in various fields.
Formula:C20H27BN2O5
InChI:InChI=1S/C20H27BN2O5/c1-7-26-18(24)17-16(21-27-19(2,3)20(4,5)28-21)13-23(22-17)12-14-8-10-15(25-6)11-9-14/h8-11,13H,7,12H2,1-6H3
InChI key:InChIKey=YRZWNOHRBBAZBX-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(=CN(CC2=CC=C(OC)C=C2)N1)B3OC(C)(C)C(C)(C)O3
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 1-[(4-methoxyphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester
  • Ethyl 1-[(4-methoxyphenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.