CAS 135529-19-0
:N-[4-[[[4-[[(5-Methyl-3-isoxazolyl)amino]sulfonyl]phenyl]amino]sulfonyl]phenyl]acetamide
Description:
N-[4-[[[4-[[(5-Methyl-3-isoxazolyl)amino]sulfonyl]phenyl]amino]sulfonyl]phenyl]acetamide, with CAS number 135529-19-0, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as sulfonamides and an isoxazole ring. This compound typically exhibits properties associated with sulfonamide derivatives, including potential antibacterial and anti-inflammatory activities. Its molecular structure suggests it may interact with biological targets, making it of interest in pharmaceutical research. The presence of the isoxazole moiety may contribute to its biological activity, as isoxazoles are known for their diverse pharmacological properties. Additionally, the compound's solubility, stability, and reactivity can be influenced by the arrangement of its functional groups. As with many synthetic compounds, its safety profile and potential toxicity would need to be evaluated through appropriate studies. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.
Formula:C18H18N4O6S2
InChI:InChI=1S/C18H18N4O6S2/c1-12-11-18(20-28-12)22-30(26,27)17-9-5-15(6-10-17)21-29(24,25)16-7-3-14(4-8-16)19-13(2)23/h3-11,21H,1-2H3,(H,19,23)(H,20,22)
InChI key:InChIKey=SQPUFLYSLCMEPT-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=CC=C(NC(C)=O)C=C1)C2=CC=C(S(NC3=NOC(C)=C3)(=O)=O)C=C2
Synonyms:- N-[4-[[[4-[[(5-Methyl-3-isoxazolyl)amino]sulfonyl]phenyl]amino]sulfonyl]phenyl]acetamide
- Acetamide, N-[4-[[[4-[[(5-methyl-3-isoxazolyl)amino]sulfonyl]phenyl]amino]sulfonyl]phenyl]-
- Lincomycin Impurity 5 Monomer(Lincomycin EP Impurity E Monomer)
- N-(4-Aminobenzenesulfonyl) Sulfamethoxazole N-Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-(4-{[(4-{[(5-methyl-3-isoxazolyl)amino]sulfonyl}phenyl)amino]sulfonyl}phenyl)acetamide
CAS:Formula:C18H18N4O6S2Purity:95%Color and Shape:SolidMolecular weight:450.4887N-(4-(N-(4-(N-(5-methylisoxazol-3-yl)sulfamoyl)phenyl)sulfamoyl)phenyl)acetamide
CAS:Purity:95%Molecular weight:450.4800109863281N-(4-Aminobenzenesulfonyl) Sulfamethoxazole N-Acetate
CAS:Controlled ProductFormula:C18H18N4O6S2Color and Shape:NeatMolecular weight:450.489N-(4-Aminobenzenesulfonyl) sulfamethoxazole N-acetate
CAS:<p>4-aminobenzenesulfonyl sulfamethoxazole N-acetate is a drug product that has been approved for use in humans. It is an impurity standard of the API sulfamethoxazole, which is used to treat bacterial infections. 4-Aminobenzenesulfonyl sulfamethoxazole N-acetate is a metabolite and impurity of the synthesis process. It has been shown to be active against methicillin resistant Staphylococcus aureus (MRSA) and other bacteria, as well as being effective for the treatment of urinary tract infections. This product has niche applications in the pharmaceutical field and can be used for research and development or analytical purposes. 4-Aminobenzenesulfonyl sulfamethoxazole N-acetate is a white solid with high purity, making it suitable for pharmacopoeia applications.</p>Formula:C18H18N4O6S2Purity:Min. 95%Molecular weight:450.5 g/mol



