CymitQuimica logo

CAS 1355328-31-2

:

1,1-Difluoro-3-isocyanocyclobutane

Description:
1,1-Difluoro-3-isocyanocyclobutane is a chemical compound characterized by its unique structure, which includes a cyclobutane ring substituted with two fluorine atoms and an isocyanate functional group. The presence of the isocyanate group (-N=C=O) contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and polymerization processes. The difluoromethyl substituents enhance the compound's stability and influence its physical properties, such as boiling and melting points, as well as its solubility in organic solvents. Additionally, the fluorine atoms can impart unique electronic properties, affecting the compound's reactivity and interactions with other molecules. Due to its structural features, 1,1-Difluoro-3-isocyanocyclobutane may have applications in materials science, pharmaceuticals, and agrochemicals, although specific applications would depend on further research and development. Safety considerations are essential when handling this compound, as isocyanates are known to be toxic and can cause respiratory issues.
Formula:C5H5F2N
InChI:InChI=1S/C5H5F2N/c1-8-4-2-5(6,7)3-4/h4H,2-3H2
InChI key:InChIKey=KYWJPXYKFWQBID-UHFFFAOYSA-N
SMILES:[N+](#[C-])C1CC(F)(F)C1
Synonyms:
  • Cyclobutane, 1,1-difluoro-3-isocyano-
  • 1,1-Difluoro-3-isocyanocyclobutane
  • (3,3-Difluorocyclobutyl)isonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.