CAS 1355334-39-2

1,1-Dimethylethyl 1,6-dihydro-6-oxo-3-pyridazinecarboxylate

Description:

1,1-Dimethylethyl 1,6-dihydro-6-oxo-3-pyridazinecarboxylate, identified by its CAS number 1355334-39-2, is a chemical compound that belongs to the class of pyridazine derivatives. This substance typically exhibits characteristics such as a relatively low molecular weight and specific functional groups that contribute to its reactivity and potential applications in organic synthesis. The presence of the dimethyl group suggests steric hindrance, which may influence its chemical behavior and interactions with other molecules. Additionally, the oxo group indicates potential for reactivity in nucleophilic addition or substitution reactions. The compound may be of interest in medicinal chemistry or agrochemical applications due to its structural features. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a unique structure that may offer various avenues for research and application in chemical sciences.

Formula: C₉H₁₂N₂O₃

InChI: InChI=1S/C9H12N2O3/c1-9(2,3)14-8(13)6-4-5-7(12)11-10-6/h4-5H,1-3H3,(H,11,12)

InChI key: InChIKey=LSJAYSOMDPBYHW-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)C=1C=CC(=O)NN1

Synonyms:

• 1,1-Dimethylethyl 1,6-dihydro-6-oxo-3-pyridazinecarboxylate
• 3-Pyridazinecarboxylic acid, 1,6-dihydro-6-oxo-, 1,1-dimethylethyl ester