CAS 1355334-48-3

1,1-Dimethylethyl 4-[[2-(methoxycarbonyl)phenyl]methyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[[2-(methoxycarbonyl)phenyl]methyl]-1-piperazinecarboxylate, identified by its CAS number 1355334-48-3, is a chemical compound characterized by its complex structure, which includes a piperazine ring, a methoxycarbonyl group, and a tert-butyl substituent. This compound typically exhibits properties associated with piperazine derivatives, such as potential biological activity, including effects on the central nervous system or other pharmacological activities. The presence of the methoxycarbonyl group suggests it may participate in various chemical reactions, including esterification or nucleophilic substitution. Additionally, the tert-butyl group contributes to its steric bulk, which can influence its solubility and reactivity. The compound's molecular structure indicates it may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its stability, solubility, and reactivity would be influenced by the specific functional groups present, making it a candidate for further study in drug design and synthesis.

Formula: C₁₈H₂₆N₂O₄

InChI: InChI=1S/C18H26N2O4/c1-18(2,3)24-17(22)20-11-9-19(10-12-20)13-14-7-5-6-8-15(14)16(21)23-4/h5-8H,9-13H2,1-4H3

InChI key: InChIKey=QFRRUTOFOGPVJF-UHFFFAOYSA-N

SMILES: C(C1=C(C(OC)=O)C=CC=C1)N2CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1,1-Dimethylethyl 4-[[2-(methoxycarbonyl)phenyl]methyl]-1-piperazinecarboxylate
• 1-Piperazinecarboxylic acid, 4-[[2-(methoxycarbonyl)phenyl]methyl]-, 1,1-dimethylethyl ester

tert-Butyl 4-[2-(Methoxycarbonyl)benzyl]piperazine-1-carboxylate

CAS: 1355334-48-3

tert-Butyl 4-[2-(Methoxycarbonyl)benzyl]piperazine-1-carboxylate

Molecular weight: 334.41g/mol

Ref: 54-OR200017