CAS 1355334-70-1

Methyl 1-[(3,4-difluorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylate

Description:

Methyl 1-[(3,4-difluorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylate is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a difluorophenyl group. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of the 3,4-difluorophenyl moiety indicates that it may exhibit interesting electronic properties due to the electronegative fluorine atoms, which can influence the compound's overall polarity and potential interactions with biological targets. The 5-oxo group suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could lead to specific biological activities. Additionally, its molecular weight and stability under standard conditions would be relevant for applications in synthesis and formulation. Overall, the characteristics of this compound make it a subject of interest for further research and potential applications in various fields.

Formula: C₁₃H₁₃F₂NO₃

InChI: InChI=1S/C13H13F2NO3/c1-19-13(18)9-5-12(17)16(7-9)6-8-2-3-10(14)11(15)4-8/h2-4,9H,5-7H2,1H3

InChI key: InChIKey=PNFYUWPNTHWWFH-UHFFFAOYSA-N

SMILES: C(N1CC(C(OC)=O)CC1=O)C2=CC(F)=C(F)C=C2

Synonyms:

• 3-Pyrrolidinecarboxylic acid, 1-[(3,4-difluorophenyl)methyl]-5-oxo-, methyl ester
• Methyl 1-[(3,4-difluorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylate

Methyl 1-(3,4-Difluorobenzyl)-5-oxopyrrolidine-3-carboxylate

CAS: 1355334-70-1

Methyl 1-(3,4-Difluorobenzyl)-5-oxopyrrolidine-3-carboxylate

Purity: 95%

Molecular weight: 269.25g/mol

Ref: 54-PC109459