
CAS 1355334-76-7
:Ethyl 7-bromo-2-methylimidazo[1,2-a]pyridine-3-carboxylate
Description:
Ethyl 7-bromo-2-methylimidazo[1,2-a]pyridine-3-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes both imidazole and pyridine rings. This compound features a bromine atom at the 7-position and an ethyl ester functional group at the 3-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group at the 2-position adds to its steric properties, influencing its interactions in chemical reactions. Ethyl 7-bromo-2-methylimidazo[1,2-a]pyridine-3-carboxylate is of interest in medicinal chemistry and may exhibit biological activity, making it a candidate for further research in drug development. Its molecular structure suggests potential for various substitution reactions, which can be exploited to create derivatives with tailored properties. As with many brominated compounds, it may also exhibit unique physical and chemical properties, including solubility and stability, which are important for its practical applications. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity.
Formula:C11H11BrN2O2
InChI:InChI=1S/C11H11BrN2O2/c1-3-16-11(15)10-7(2)13-9-6-8(12)4-5-14(9)10/h4-6H,3H2,1-2H3
InChI key:InChIKey=CIELDANZYKPNTF-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N2C(=NC1C)C=C(Br)C=C2
Synonyms:- Ethyl 7-bromo-2-methylimidazo[1,2-a]pyridine-3-carboxylate
- Imidazo[1,2-a]pyridine-3-carboxylic acid, 7-bromo-2-methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.