CAS 1355334-84-7

Methyl 5-(3-bromophenyl)-3-methyl-4-isoxazolecarboxylate

Description:

Methyl 5-(3-bromophenyl)-3-methyl-4-isoxazolecarboxylate is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a bromophenyl group, indicating the presence of a bromine atom attached to a phenyl ring, which can influence its reactivity and biological activity. The methyl groups contribute to its overall hydrophobic character, potentially affecting its solubility in various solvents. The carboxylate functional group suggests that it may exhibit acidic properties, which can be relevant in various chemical reactions or biological interactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the isoxazole moiety, which is often associated with various biological activities. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods and can vary based on purity and environmental conditions.

Formula: C₁₂H₁₀BrNO₃

InChI: InChI=1S/C12H10BrNO3/c1-7-10(12(15)16-2)11(17-14-7)8-4-3-5-9(13)6-8/h3-6H,1-2H3

InChI key: InChIKey=FPMCQOBEMFGJFU-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(ON=C1C)C2=CC(Br)=CC=C2

Synonyms:

• 4-Isoxazolecarboxylic acid, 5-(3-bromophenyl)-3-methyl-, methyl ester
• Methyl 5-(3-bromophenyl)-3-methyl-4-isoxazolecarboxylate

Methyl 5-(3-bromophenyl)-3-methylisoxazole-4-carboxylate

CAS: 1355334-84-7

Formula: C₁₂H₁₀BrNO₃

Purity: 95.0%

Molecular weight: 296.12

Ref: 10-F317568