CAS 1355334-90-5

Methyl 5-(2-bromophenyl)-3-methyl-4-isoxazolecarboxylate

Description:

Methyl 5-(2-bromophenyl)-3-methyl-4-isoxazolecarboxylate is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a bromophenyl group, indicating the presence of a bromine atom attached to a phenyl ring, which contributes to its potential reactivity and biological activity. The methyl groups in the structure enhance its lipophilicity, potentially influencing its solubility and interaction with biological systems. The carboxylate functional group suggests that it may participate in various chemical reactions, including esterification and nucleophilic substitutions. This compound may be of interest in medicinal chemistry and material science due to its unique structural features, which could lead to specific pharmacological properties or applications in organic synthesis. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including solvent, temperature, and the presence of other reagents.

Formula: C₁₂H₁₀BrNO₃

InChI: InChI=1S/C12H10BrNO3/c1-7-10(12(15)16-2)11(17-14-7)8-5-3-4-6-9(8)13/h3-6H,1-2H3

InChI key: InChIKey=LAOMMHCVJKZXLT-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(ON=C1C)C2=C(Br)C=CC=C2

Synonyms:

• 4-Isoxazolecarboxylic acid, 5-(2-bromophenyl)-3-methyl-, methyl ester
• Methyl 5-(2-bromophenyl)-3-methyl-4-isoxazolecarboxylate

Methyl 5-(2-bromophenyl)-3-methylisoxazole-4-carboxylate

CAS: 1355334-90-5

Formula: C₁₂H₁₀BrNO₃

Purity: 95.0%

Molecular weight: 296.12

Ref: 10-F317566