CAS 1355334-95-0

1H-Pyrazole-5-carboximidamide, 3-(1,1-dimethylethyl)-1-methyl-, hydrochloride (1:1)

Description:

1H-Pyrazole-5-carboximidamide, 3-(1,1-dimethylethyl)-1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboximidamide functional group, contributing to its potential reactivity and biological activity. The presence of a tert-butyl group (1,1-dimethylethyl) and a methyl group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in pharmaceuticals and research. The compound's CAS number, 1355334-95-0, allows for precise identification in chemical databases. Its specific properties, such as melting point, boiling point, and spectral data, would require experimental determination or reference to specialized literature. Overall, this compound's unique structure and functional groups suggest potential utility in medicinal chemistry and related fields.

Formula: C₉H₁₆N₄·ClH

InChI: InChI=1S/C9H16N4.ClH/c1-9(2,3)7-5-6(8(10)11)13(4)12-7;/h5H,1-4H3,(H3,10,11);1H

InChI key: InChIKey=XMXUPVQMJJOKJD-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C=1C=C(C(=N)N)N(C)N1.Cl

Synonyms:

• 1H-Pyrazole-5-carboximidamide, 3-(1,1-dimethylethyl)-1-methyl-, hydrochloride (1:1)