CymitQuimica logo

CAS 1355612-99-5

:

2-(Iodomethyl)-5-(trifluoromethyl)benzothiazole

Description:
2-(Iodomethyl)-5-(trifluoromethyl)benzothiazole is a chemical compound characterized by its unique structure, which includes a benzothiazole core substituted with both an iodomethyl group and a trifluoromethyl group. The presence of the iodomethyl group introduces a halogen, which can enhance the compound's reactivity and potential applications in organic synthesis and medicinal chemistry. The trifluoromethyl group is known for imparting significant lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical development. This compound is likely to exhibit properties typical of halogenated aromatic compounds, such as increased stability and potential for electrophilic substitution reactions. Additionally, the benzothiazole moiety is often associated with various biological activities, including antimicrobial and anticancer properties. Overall, 2-(Iodomethyl)-5-(trifluoromethyl)benzothiazole presents a versatile scaffold for further chemical modifications and applications in research and industry.
Formula:C9H5F3INS
InChI:InChI=1S/C9H5F3INS/c10-9(11,12)5-1-2-7-6(3-5)14-8(4-13)15-7/h1-3H,4H2
InChI key:InChIKey=ZEFAEXWZEUHHCP-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C2C(SC(CI)=N2)=CC1
Synonyms:
  • 2-(Iodomethyl)-5-(trifluoromethyl)-1,3-benzothiazole
  • Benzothiazole, 2-(iodomethyl)-5-(trifluoromethyl)-
  • 2-(Iodomethyl)-5-(trifluoromethyl)benzo[d]thiazole
  • 2-(Iodomethyl)-5-(trifluoromethyl)benzothiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.