
CAS 135574-57-1
:β-D-Glucopyranoside, (6aR,12aR)-6a,12a-dihydro-6H-[1,3]dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3-yl, 6-(hydrogen propanedioate)
Description:
The chemical substance known as β-D-Glucopyranoside, (6aR,12aR)-6a,12a-dihydro-6H-[1,3]dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3-yl, 6-(hydrogen propanedioate) is a complex organic compound characterized by its glycosidic structure, which includes a glucose moiety linked to a benzofuro[3,2-c][1]benzopyran derivative. This compound features multiple functional groups, including a dioxole ring and a propanedioate moiety, contributing to its potential biological activity and solubility properties. The stereochemistry indicated by the (6aR,12aR) configuration suggests specific spatial arrangements of atoms that may influence its interactions in biological systems. The presence of the glucopyranoside unit may enhance its solubility in aqueous environments, making it relevant for various applications in biochemistry and pharmacology. Additionally, the compound's structural complexity may allow for diverse interactions with biological targets, potentially leading to interesting pharmacological properties. Further studies would be necessary to elucidate its specific functions and applications in medicinal chemistry.
Formula:C25H24O13
InChI:InChI=1S/C25H24O13/c26-19(27)6-20(28)33-8-18-21(29)22(30)23(31)25(38-18)36-10-1-2-11-14(3-10)32-7-13-12-4-16-17(35-9-34-16)5-15(12)37-24(11)13/h1-5,13,18,21-25,29-31H,6-9H2,(H,26,27)/t13-,18+,21+,22-,23+,24-,25+/m0/s1
InChI key:InChIKey=ZHXRWFOBROFZAC-LVYGOKBNSA-N
SMILES:O(C=1C=C2C([C@]3([C@](C=4C(O3)=CC5=C(C4)OCO5)(CO2)[H])[H])=CC1)[C@@H]6O[C@H](COC(CC(O)=O)=O)[C@@H](O)[C@H](O)[C@H]6O
Synonyms:- Trifolirhizin 6′-O-malonate
- (-)-Maackiain-3-O-glucosyl-6′′-malonate
- β-D-Glucopyranoside, 6a,12a-dihydro-6H-[1,3]dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3-yl, 6-(hydrogen propanedioate), (6aR-cis)-
- 6H-[1,3]Dioxolo[5,6]benzofuro[3,2-c][1]benzopyran, β-D-glucopyranoside deriv.
- β-D-Glucopyranoside, (6aR,12aR)-6a,12a-dihydro-6H-[1,3]dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3-yl, 6-(hydrogen propanedioate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6'-Malonyltrifolirhizin
CAS:<p>6'-Malonyltrifolirhizin is a useful organic compound for research related to life sciences. The catalog number is T125999 and the CAS number is 135574-57-1.</p>Formula:C25H24O13Color and Shape:SolidMolecular weight:532.454
