CAS 135575-42-7: Pneumocandin B0
Description:Pneumocandin B0 is a lipopeptide compound that belongs to the class of echinocandins, which are known for their antifungal properties. It is produced by the fermentation of certain fungi, particularly species of Glarea lozoyensis. The structure of Pneumocandin B0 features a cyclic hexapeptide core linked to a long fatty acid chain, which contributes to its biological activity. This compound primarily acts by inhibiting the synthesis of β-(1,3)-D-glucan, an essential component of fungal cell walls, thereby exerting fungicidal effects against various pathogenic fungi, including Candida species. Pneumocandin B0 has been studied for its potential therapeutic applications, particularly in treating invasive fungal infections. Its solubility and stability characteristics make it suitable for formulation into pharmaceutical preparations. Additionally, it has a favorable safety profile, which is crucial for its use in clinical settings. Overall, Pneumocandin B0 represents an important compound in the development of antifungal therapies, particularly in the context of increasing resistance to conventional antifungal agents.
Formula:C50H80N8O17
InChI:InChI=1/C50H80N8O17/c1-5-25(2)20-26(3)12-10-8-6-7-9-11-13-37(66)52-31-22-35(64)46(71)56-48(73)41-33(62)18-19-57(41)50(75)39(34(63)23-36(51)65)54-47(72)40(43(68)42(67)28-14-16-29(60)17-15-28)55-45(70)32-21-30(61)24-58(32)49(74)38(27(4)59)53-44(31)69/h14-17,25-27,30-35,38-43,46,59-64,67-68,71H,5-13,18-24H2,1-4H3,(H2,51,65)(H,52,66)(H,53,69)(H,54,72)(H,55,70)(H,56,73)/t25?,26?,27-,30+,31-,32-,33-,34-,35+,38-,39-,40-,41-,42-,43-,46+/m0/s1
- Synonyms:
- Pneumocardin B0
- pneumocandin B(0)
- N-{(2R,6S,9S,11R,12R,14aS,15S,20S,23S,25aS)-20-[(1S)-3-amino-1-hydroxy-3-oxopropyl]-23-[(1S,2S)-1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-2,11,12,15-tetrahydroxy-6-[(1S)-1-hydroxyethyl]-5,8,14,19,22,25-hexaoxotetracosahydro-1H-dipyrrolo[2,1-c:2',1'-l][1,4,7,10,13,16]hexaazacyclohenicosin-9-yl}-10,12-dimethyltetradecanamide