CAS 13558-77-5

2-chloro-N-[(4-methylphenyl)carbamoyl]acetamide

Description:

2-Chloro-N-[(4-methylphenyl)carbamoyl]acetamide, with the CAS number 13558-77-5, is an organic compound characterized by its amide functional group and the presence of a chloro substituent. This compound features a chloro group attached to the second carbon of the acetamide moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 4-methylphenyl group enhances its lipophilicity, potentially influencing its solubility and biological activity. As an amide, it may exhibit hydrogen bonding capabilities, affecting its physical properties such as melting point and boiling point. The compound's structure suggests potential uses in pharmaceuticals or agrochemicals, where modifications to the amide or aromatic ring can lead to varied biological activities. Safety and handling precautions are essential due to the presence of chlorine, which can pose health risks. Overall, 2-chloro-N-[(4-methylphenyl)carbamoyl]acetamide is a compound of interest in chemical research and development, particularly in the fields of medicinal chemistry and material science.

Formula: C₁₀H₁₁ClN₂O₂

InChI: InChI=1/C10H11ClN2O2/c1-7-2-4-8(5-3-7)12-10(15)13-9(14)6-11/h2-5H,6H2,1H3,(H2,12,13,14,15)

SMILES: Cc1ccc(cc1)NC(=O)N=C(CCl)O

Synonyms:

• acetamide, 2-chloro-N-[[(4-methylphenyl)amino]carbonyl]-

3-(2-Chloroacetyl)-1-(4-methylphenyl)urea

CAS: 13558-77-5

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 226.66 g/mol

Ref: 3D-NAA55877