CAS 13558-78-6

2-Chloro-N-[[(4-methoxyphenyl)amino]carbonyl]acetamide

Description:

2-Chloro-N-[[(4-methoxyphenyl)amino]carbonyl]acetamide, with the CAS number 13558-78-6, is a chemical compound characterized by its amide functional group and the presence of a chloro substituent. This compound features a chloro group attached to a carbon atom adjacent to an acetamide moiety, which is further substituted with a 4-methoxyphenyl group. The methoxy group enhances the compound's lipophilicity and may influence its biological activity. Typically, compounds of this nature exhibit moderate to high solubility in organic solvents and may have limited solubility in water due to their hydrophobic characteristics. The presence of the chloro group can impart unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₁ClN₂O₃

InChI: InChI=1/C10H11ClN2O3/c1-16-8-4-2-7(3-5-8)12-10(15)13-9(14)6-11/h2-5H,6H2,1H3,(H2,12,13,14,15)

InChI key: InChIKey=ODWKXORLQVYKOE-UHFFFAOYSA-N

SMILES: N(C(NC(CCl)=O)=O)C1=CC=C(OC)C=C1

Synonyms:

• 2-chloro-N-[(4-methoxyphenyl)carbamoyl]acetamide
• Acetamide, 2-chloro-N-[[(4-methoxyphenyl)amino]carbonyl]-
• Urea, 1-(chloroacetyl)-3-(p-methoxyphenyl)-
• 2-chloro-N-{[(4-methoxyphenyl)amino]carbonyl}acetamide
• 2-Chloro-N-[[(4-methoxyphenyl)amino]carbonyl]acetamide

3-(2-Chloroacetyl)-1-(4-methoxyphenyl)urea

CAS: 13558-78-6

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClN₂O₃

Purity: Min. 95%

Molecular weight: 242.66 g/mol

Ref: 3D-NAA55878