CymitQuimica logo

CAS 13558-79-7

:

N-{[(4-BROMOPHENYL)AMINO]CARBONYL}-2-CHLOROACETAMIDE

Description:
N-{[(4-Bromophenyl)amino]carbonyl}-2-chloroacetamide, with the CAS number 13558-79-7, is a chemical compound characterized by its unique functional groups and structural features. It contains a bromophenyl moiety, which contributes to its aromatic properties and potential reactivity. The presence of the amide functional group indicates that it can participate in hydrogen bonding, influencing its solubility and interaction with biological systems. The chlorine atom in the 2-position of the acetamide enhances its electrophilic character, making it a potential candidate for various chemical reactions. This compound may exhibit biological activity, possibly serving as a pharmaceutical intermediate or a research chemical. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological targets. Additionally, the presence of halogens may affect its stability and reactivity, making it an interesting subject for further study in organic synthesis and drug design. Overall, N-{[(4-Bromophenyl)amino]carbonyl}-2-chloroacetamide is a compound of interest due to its diverse chemical properties and potential applications.
Formula:C9H8BrClN2O2
InChI:InChI=1/C9H8BrClN2O2/c10-6-1-3-7(4-2-6)12-9(15)13-8(14)5-11/h1-4H,5H2,(H2,12,13,14,15)
SMILES:c1cc(ccc1Br)NC(=O)N=C(CCl)O
Synonyms:
  • N-[(4-bromophenyl)carbamoyl]-2-chloroacetamide
  • N-{[(4-bromophenyl)amino]carbonyl}-2-chloroacetamide
Found 1 products.