CAS 135591-00-3
:Mefenpyr
Description:
Mefenpyr, with the CAS number 135591-00-3, is a chemical compound primarily used as a plant growth regulator and herbicide. It belongs to the class of pyridine derivatives and is characterized by its ability to inhibit the growth of certain weeds while promoting the growth of crops. Mefenpyr acts by interfering with the biosynthesis of specific plant hormones, leading to altered growth patterns. It is typically applied in agricultural settings to enhance crop yield and manage weed populations. The compound is known for its selective action, which minimizes harm to desirable plants while effectively controlling unwanted species. Mefenpyr is generally considered to have low toxicity to humans and animals, but like all agrochemicals, it should be handled with care, following safety guidelines to mitigate any potential environmental impact. Its efficacy and safety profile make it a valuable tool in modern agricultural practices, contributing to sustainable farming efforts.
Formula:C12H10Cl2N2O4
InChI:InChI=1/C12H10Cl2N2O4/c1-12(11(19)20)5-8(10(17)18)15-16(12)9-3-2-6(13)4-7(9)14/h2-4H,5H2,1H3,(H,17,18)(H,19,20)
InChI key:InChIKey=XEJNEDVTJPXRSM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(C)N(N=C(C(O)=O)C1)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- 1-(2,4-Dichlorophenyl)-4,5-dihydro-5-methyl-1H-pyrazole-3,5-dicarboxylic acid
- 1-(2,4-dichlorophenyl)-5-methyl-4,5-dihydro-1H-pyrazole-3,5-dicarboxylic acid
- 1H-Pyrazole-3,5-dicarboxylic acid, 1-(2,4-dichlorophenyl)-4,5-dihydro-5-methyl-
- Hoe 113225
- Mefenpyr-Diethyl Pestanal
- Mefenpyr-Diethyl Pestanal 100Mg
- Mefenpyr
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

