CAS 1355990-11-2
:{[(5S)-1-Decyn-5-yloxy]methyl}benzene
Description:
{[(5S)-1-Decyn-5-yloxy]methyl}benzene, identified by its CAS number 1355990-11-2, is an organic compound characterized by a benzene ring substituted with a long aliphatic chain. The presence of a decynyl group indicates that it contains a triple bond between carbon atoms, which contributes to its reactivity and potential applications in organic synthesis. The "5S" designation suggests that the compound has a specific stereochemistry, which can influence its physical and chemical properties, such as boiling point, solubility, and reactivity. The ether functional group, indicated by the "yloxy" portion, suggests that the compound may exhibit properties typical of ethers, including moderate polarity and potential for hydrogen bonding. This compound may be of interest in fields such as materials science, pharmaceuticals, or organic chemistry due to its unique structure and functional groups, which can facilitate various chemical reactions and interactions. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C17H24O
InChI:InChI=1S/C17H24O/c1-3-5-8-14-17(13-6-4-2)18-15-16-11-9-7-10-12-16/h2,7,9-12,17H,3,5-6,8,13-15H2,1H3/t17-/m1/s1
SMILES:CCCCC[C@@H](CCC#C)OCc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
