CAS 13560-91-3
:1,2,3,4,5,6,7,8,10,10,11,11-dodecachloro-4,4a,4b,5,8,8a,9,9a-octahydro-1H-1,4:5,8-dimethanofluorene
Description:
The chemical substance known as "1,2,3,4,5,6,7,8,10,10,11,11-dodecachloro-4,4a,4b,5,8,8a,9,9a-octahydro-1H-1,4:5,8-dimethanofluorene," with the CAS number 13560-91-3, is a chlorinated hydrocarbon. This compound is characterized by its complex structure, which includes multiple chlorine substituents and a fused polycyclic framework. The presence of dodecachloro groups indicates a high degree of chlorination, which significantly influences its chemical properties, including stability and reactivity. Such chlorinated compounds are often resistant to degradation, making them persistent in the environment. They may exhibit hydrophobic characteristics, leading to bioaccumulation in living organisms. Additionally, the compound's structure suggests potential applications in various fields, including materials science and as a flame retardant, although its environmental impact and toxicity must be carefully considered. Overall, this substance exemplifies the intricate relationship between molecular structure and chemical behavior, particularly in the context of chlorinated organic compounds.
Formula:C15H6Cl12
InChI:InChI=1/C15H6Cl12/c16-6-8(18)12(22)4-2(10(6,20)14(12,24)25)1-3-5(4)13(23)9(19)7(17)11(3,21)15(13,26)27/h2-5H,1H2
SMILES:C1C2C(C3C1C1(C(=C(C3(C1(Cl)Cl)Cl)Cl)Cl)Cl)C1(C(=C(C2(C1(Cl)Cl)Cl)Cl)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NSC 91800
CAS:Controlled ProductApplications Flame Retardant commonly applied to plastics
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C15H6Cl12Color and Shape:NeatMolecular weight:611.64
