CAS 1356003-23-0
:2-Cyclopropylpyrazolo[1,5-a]pyrimidin-6-amine
Description:
2-Cyclopropylpyrazolo[1,5-a]pyrimidin-6-amine is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrazole and a pyrimidine moiety. This compound features a cyclopropyl group, contributing to its distinct three-membered ring structure, which can influence its reactivity and biological activity. The presence of an amine functional group at the 6-position of the pyrimidine ring suggests potential for hydrogen bonding and interaction with biological targets, making it of interest in medicinal chemistry. The compound's molecular framework may exhibit properties such as moderate lipophilicity and the ability to engage in π-π stacking interactions, which are relevant in drug design. Additionally, the specific arrangement of atoms and functional groups can affect its solubility, stability, and overall pharmacokinetic profile. As a result, 2-Cyclopropylpyrazolo[1,5-a]pyrimidin-6-amine may be explored for its potential therapeutic applications, particularly in the fields of oncology or neurology, where similar structures have shown promise.
Formula:C9H10N4
InChI:InChI=1S/C9H10N4/c10-7-4-11-9-3-8(6-1-2-6)12-13(9)5-7/h3-6H,1-2,10H2
InChI key:InChIKey=WYYRERHSUZELCK-UHFFFAOYSA-N
SMILES:NC1=CN2N=C(C=C2N=C1)C3CC3
Synonyms:- 2-Cyclopropylpyrazolo[1,5-a]pyrimidin-6-amine
- Pyrazolo[1,5-a]pyrimidin-6-amine, 2-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.