CymitQuimica logo

CAS 1356016-34-6

:

5-Chlorothieno[3,2-b]pyridine-3-carboxylic acid

Description:
5-Chlorothieno[3,2-b]pyridine-3-carboxylic acid is a heterocyclic compound characterized by the presence of both a thieno and pyridine ring structure, which contributes to its unique chemical properties. The compound features a chlorine substituent at the 5-position of the thieno ring and a carboxylic acid functional group at the 3-position of the pyridine ring. This configuration imparts both acidic and polar characteristics, making it soluble in polar solvents. The presence of the chlorine atom enhances the compound's reactivity and can influence its biological activity, potentially making it of interest in pharmaceutical applications. The thieno and pyridine moieties contribute to its aromaticity, which can affect its stability and interaction with other molecules. Overall, 5-Chlorothieno[3,2-b]pyridine-3-carboxylic acid is a compound of interest in organic synthesis and medicinal chemistry due to its structural features and potential applications in drug development.
Formula:C8H4ClNO2S
InChI:InChI=1S/C8H4ClNO2S/c9-6-2-1-5-7(10-6)4(3-13-5)8(11)12/h1-3H,(H,11,12)
InChI key:InChIKey=DHMWTHARWQKMLE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(SC1)=CC=C(Cl)N2
Synonyms:
  • Thieno[3,2-b]pyridine-3-carboxylic acid, 5-chloro-
  • 5-Chlorothieno[3,2-b]pyridine-3-carboxylic acid
Found 3 products.