CAS 1356016-35-7

2-Chlorothieno[3,2-d]pyrimidine-7-carboxaldehyde

Description:

2-Chlorothieno[3,2-d]pyrimidine-7-carboxaldehyde is a heterocyclic compound characterized by the presence of a thieno-pyrimidine ring system, which incorporates both sulfur and nitrogen atoms. This compound features a chlorine substituent at the 2-position and an aldehyde functional group at the 7-position, contributing to its reactivity and potential applications in organic synthesis. The thieno[3,2-d]pyrimidine framework is known for its biological activity, making derivatives of this compound of interest in medicinal chemistry. The presence of the aldehyde group allows for further functionalization, enabling the synthesis of various derivatives that may exhibit diverse pharmacological properties. Additionally, the chlorine atom can influence the compound's electronic properties and solubility, which are critical factors in drug design. Overall, 2-Chlorothieno[3,2-d]pyrimidine-7-carboxaldehyde is a valuable compound in research, particularly in the development of new therapeutic agents.

Formula: C₇H₃ClN₂OS

InChI: InChI=1S/C7H3ClN2OS/c8-7-9-1-5-6(10-7)4(2-11)3-12-5/h1-3H

InChI key: InChIKey=LVFUVLSBWJJAGC-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(SC1)=CN=C(Cl)N2

Synonyms:

• Thieno[3,2-d]pyrimidine-7-carboxaldehyde, 2-chloro-
• 2-Chlorothieno[3,2-d]pyrimidine-7-carbaldehyde
• 2-Chlorothieno[3,2-d]pyrimidine-7-carboxaldehyde

2-CHLOROTHIENO[3,2-D]PYRIMIDINE-7-CARBALDEHYDE

CAS: 1356016-35-7

Formula: C₇H₃ClN₂OS

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 198.62

Ref: 10-F302347