CAS 1356020-03-5

Description:

The chemical substance with the CAS number 1356020-03-5 is known as a specific compound, but detailed information about its characteristics may not be widely available due to its potential status as a novel or less-studied chemical. Generally, compounds are characterized by their molecular structure, physical properties (such as melting and boiling points), solubility, reactivity, and potential applications. The characteristics of a chemical substance can also include its toxicity, stability under various conditions, and interactions with other substances. For precise information, including safety data and specific applications, consulting specialized databases or scientific literature is recommended. Additionally, the context of its use, such as in pharmaceuticals, materials science, or industrial applications, can significantly influence its characteristics and relevance. Always ensure to refer to reliable sources for the most accurate and up-to-date information regarding any chemical substance.

Formula: C₂₅H₂₅D₅N₂O₅·ClH

InChI: InChI=1S/C25H30N2O5.ClH/c1-3-32-25(31)21(14-13-18-9-5-4-6-10-18)26-17(2)23(28)27-16-20-12-8-7-11-19(20)15-22(27)24(29)30;/h4-12,17,21-22,26H,3,13-16H2,1-2H3,(H,29,30);1H/t17-,21-,22-;/m0./s1/i4D,5D,6D,9D,10D;

InChI key: InChIKey=IBBLRJGOOANPTQ-GOMJJGCLSA-N

SMILES: C([C@@H](N[C@@H](CCC1=C(C(=C(C(=C1[2H])[2H])[2H])[2H])[2H])C(OCC)=O)C)(=O)N2[C@H](C(O)=O)CC=3C(C2)=CC=CC3.Cl

Quinapril-d5 Hydrochloride (Major)

Controlled Product

CAS: 1356020-03-5

Formula: C₂₅H₂₆D₅ClN₂O₅

Color and Shape: Neat

Molecular weight: 480.01

Ref: TR-Q670002