CymitQuimica logo

CAS 1356086-78-6

:

1-(4-Chloro-2-pyridinyl)-2,2,2-trifluoroethanone

Description:
1-(4-Chloro-2-pyridinyl)-2,2,2-trifluoroethanone, identified by its CAS number 1356086-78-6, is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and a trifluoroethanone moiety. This compound typically exhibits properties associated with both aromatic and halogenated compounds, such as increased stability and potential reactivity due to the presence of the trifluoroethanone functional group. The chlorine atom contributes to its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. The trifluoromethyl group enhances the compound's electron-withdrawing characteristics, which can affect its reactivity in various chemical reactions. Additionally, this compound may exhibit specific solubility characteristics in organic solvents, and its polar nature can influence its interactions in biological systems. Overall, 1-(4-Chloro-2-pyridinyl)-2,2,2-trifluoroethanone is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C7H3ClF3NO
InChI:InChI=1S/C7H3ClF3NO/c8-4-1-2-12-5(3-4)6(13)7(9,10)11/h1-3H
InChI key:InChIKey=GVZHTULAQCNBCU-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=CC(Cl)=CC=N1
Synonyms:
  • 1-(4-Chloropyridin-2-yl)-2,2,2-trifluoroethan-1-one
  • Ethanone, 1-(4-chloro-2-pyridinyl)-2,2,2-trifluoro-
  • 1-(4-Chloro-2-pyridinyl)-2,2,2-trifluoroethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.