
CAS 1356087-32-5
:2-Chloro-6,7-dihydro-6-[(4-methoxyphenyl)methyl]-5H-pyrrolo[3,4-b]pyridine
Description:
2-Chloro-6,7-dihydro-6-[(4-methoxyphenyl)methyl]-5H-pyrrolo[3,4-b]pyridine is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrolopyridine framework. This compound features a chlorine atom at the 2-position and a methoxyphenylmethyl group at the 6-position, contributing to its unique reactivity and potential biological activity. The presence of the methoxy group enhances lipophilicity, which may influence its pharmacokinetic properties. The compound is likely to exhibit moderate to high stability under standard conditions, although specific stability data would depend on environmental factors such as temperature and pH. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the presence of the chlorine atom may impart specific electronic properties that could affect its interaction with biological targets. Overall, this compound represents a class of heterocyclic compounds that are of interest in drug discovery and development.
Formula:C15H15ClN2O
InChI:InChI=1S/C15H15ClN2O/c1-19-13-5-2-11(3-6-13)8-18-9-12-4-7-15(16)17-14(12)10-18/h2-7H,8-10H2,1H3
InChI key:InChIKey=RFQFRSLFDKLJHD-UHFFFAOYSA-N
SMILES:C(N1CC=2C(C1)=NC(Cl)=CC2)C3=CC=C(OC)C=C3
Synonyms:- 5H-Pyrrolo[3,4-b]pyridine, 2-chloro-6,7-dihydro-6-[(4-methoxyphenyl)methyl]-
- 2-Chloro-6,7-dihydro-6-[(4-methoxyphenyl)methyl]-5H-pyrrolo[3,4-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Chloro-6-(4-methoxybenzyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine
CAS:Formula:C15H15ClN2OMolecular weight:274.7454
