CAS 1356087-50-7
:4-Piperidineethanol, β-(chloromethyl)-, hydrochloride (1:1)
Description:
4-Piperidineethanol, β-(chloromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This substance features a chloromethyl group attached to the β-position of the piperidine ring, contributing to its reactivity and potential applications in organic synthesis. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various chemical reactions and biological studies. Typically, compounds of this nature may exhibit properties such as basicity due to the presence of the nitrogen atom in the piperidine ring, and they may also possess biological activity, which could be of interest in pharmaceutical research. The molecular structure allows for potential interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. As with many chemical substances, safety precautions should be observed when handling this compound due to its potential reactivity and biological effects.
Formula:C8H16ClNO·ClH
InChI:InChI=1S/C8H16ClNO.ClH/c9-5-8(6-11)7-1-3-10-4-2-7;/h7-8,10-11H,1-6H2;1H
InChI key:InChIKey=MDJBISZJOOIVFJ-UHFFFAOYSA-N
SMILES:C(CCl)(CO)C1CCNCC1.Cl
Synonyms:- 4-Piperidineethanol, β-(chloromethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
