CymitQuimica logo

CAS 1356087-51-8

:

3-Bromo-6,7-dihydro-6-[(4-methoxyphenyl)methyl]-5H-pyrrolo[3,4-b]pyridine

Description:
3-Bromo-6,7-dihydro-6-[(4-methoxyphenyl)methyl]-5H-pyrrolo[3,4-b]pyridine is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrolopyridine framework. The presence of a bromine atom at the 3-position and a methoxyphenylmethyl group at the 6-position contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic methoxy group, which may influence its solubility and permeability in biological systems. The bromine substituent can also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the compound may possess interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its stability can be influenced by environmental factors such as light and temperature. Overall, 3-Bromo-6,7-dihydro-6-[(4-methoxyphenyl)methyl]-5H-pyrrolo[3,4-b]pyridine represents a valuable structure for exploring new chemical and biological applications.
Formula:C15H15BrN2O
InChI:InChI=1S/C15H15BrN2O/c1-19-14-4-2-11(3-5-14)8-18-9-12-6-13(16)7-17-15(12)10-18/h2-7H,8-10H2,1H3
InChI key:InChIKey=SPITYEDCKVPGCV-UHFFFAOYSA-N
SMILES:C(N1CC=2C(C1)=CC(Br)=CN2)C3=CC=C(OC)C=C3
Synonyms:
  • 3-Bromo-6,7-dihydro-6-[(4-methoxyphenyl)methyl]-5H-pyrrolo[3,4-b]pyridine
  • 5H-Pyrrolo[3,4-b]pyridine, 3-bromo-6,7-dihydro-6-[(4-methoxyphenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.