CAS 1356087-56-3
:1,1-Dimethylethyl N-[3-[bis(phenylmethyl)amino]cyclobutyl]carbamate
Description:
1,1-Dimethylethyl N-[3-[bis(phenylmethyl)amino]cyclobutyl]carbamate, identified by its CAS number 1356087-56-3, is a chemical compound that features a complex structure characterized by the presence of a carbamate functional group. This compound contains a cyclobutyl moiety, which contributes to its cyclic structure, and is further substituted with a bis(phenylmethyl)amino group, indicating the presence of two phenylmethyl groups attached to a nitrogen atom. The dimethylethyl group adds steric bulk, which can influence the compound's reactivity and solubility. Generally, compounds of this nature may exhibit interesting biological activities, making them of interest in medicinal chemistry. The presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can affect the compound's physical properties, such as melting point and solubility in organic solvents. Additionally, the overall molecular structure may impart specific pharmacokinetic properties, influencing absorption, distribution, metabolism, and excretion in biological systems.
Formula:C23H30N2O2
InChI:InChI=1S/C23H30N2O2/c1-23(2,3)27-22(26)24-20-14-21(15-20)25(16-18-10-6-4-7-11-18)17-19-12-8-5-9-13-19/h4-13,20-21H,14-17H2,1-3H3,(H,24,26)
InChI key:InChIKey=LCORYCZNNVHEBO-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CC2=CC=CC=C2)C3CC(NC(OC(C)(C)C)=O)C3
Synonyms:- Carbamic acid, N-[3-[bis(phenylmethyl)amino]cyclobutyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[3-[bis(phenylmethyl)amino]cyclobutyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
