CAS 1356087-63-2
:3-(4-Methylphenyl)-6-nitro-1H-indazole
Description:
3-(4-Methylphenyl)-6-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a 4-methylphenyl group indicates a para-substituted aromatic ring, contributing to the compound's overall hydrophobicity and potential for π-π interactions. The nitro group at the 6-position of the indazole enhances the compound's reactivity and can influence its electronic properties, making it a candidate for various chemical reactions. This compound may exhibit biological activity, potentially serving as a lead compound in pharmaceutical research. Its molecular structure suggests it could interact with biological targets, although specific biological activities would require empirical investigation. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the indazole ring, which may affect its applications in medicinal chemistry or materials science. Safety and handling considerations should be taken into account, as nitro compounds can be sensitive and may pose health risks.
Formula:C14H11N3O2
InChI:InChI=1S/C14H11N3O2/c1-9-2-4-10(5-3-9)14-12-7-6-11(17(18)19)8-13(12)15-16-14/h2-8H,1H3,(H,15,16)
InChI key:InChIKey=WOFQSPQUEACDQT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(C(=NN2)C3=CC=C(C)C=C3)=CC1
Synonyms:- 1H-Indazole, 3-(4-methylphenyl)-6-nitro-
- 3-(4-Methylphenyl)-6-nitro-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
