CymitQuimica logo

CAS 1356087-71-2

:

3-(5-Amino-1H-indazol-3-yl)benzonitrile

Description:
3-(5-Amino-1H-indazol-3-yl)benzonitrile, identified by its CAS number 1356087-71-2, is a chemical compound characterized by its structural features that include an indazole moiety and a benzonitrile group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. The amino group in the indazole ring can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the benzonitrile portion contributes to the compound's electronic properties, making it a candidate for applications in pharmaceuticals or as a building block in organic synthesis. The presence of both nitrogen and carbon functionalities suggests potential for interactions in biological systems, which may be explored in drug development or material science. Overall, this compound's unique structure and functional groups position it as a versatile entity in chemical research and applications.
Formula:C14H10N4
InChI:InChI=1S/C14H10N4/c15-8-9-2-1-3-10(6-9)14-12-7-11(16)4-5-13(12)17-18-14/h1-7H,16H2,(H,17,18)
InChI key:InChIKey=UBWDTYFEBQDFLN-UHFFFAOYSA-N
SMILES:NC=1C=C2C(=NNC2=CC1)C3=CC(C#N)=CC=C3
Synonyms:
  • 3-(5-Amino-1H-indazol-3-yl)benzonitrile
  • Benzonitrile, 3-(5-amino-1H-indazol-3-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.