CAS 1356087-74-5
:4-(5-Amino-1H-indazol-3-yl)benzonitrile
Description:
4-(5-Amino-1H-indazol-3-yl)benzonitrile is a chemical compound characterized by its unique structure, which includes an indazole moiety and a benzonitrile group. This compound features an amino group attached to the indazole ring, contributing to its potential reactivity and biological activity. The presence of the benzonitrile group suggests that it may exhibit properties typical of aromatic nitriles, such as being a potential ligand in coordination chemistry or a precursor in organic synthesis. The compound's molecular structure allows for various interactions, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, its solubility and stability in various solvents can influence its application in research and industry. Overall, 4-(5-Amino-1H-indazol-3-yl)benzonitrile represents a versatile scaffold for further chemical modifications and investigations into its potential therapeutic uses.
Formula:C14H10N4
InChI:InChI=1S/C14H10N4/c15-8-9-1-3-10(4-2-9)14-12-7-11(16)5-6-13(12)17-18-14/h1-7H,16H2,(H,17,18)
InChI key:InChIKey=BJJKSRQHWSDYKC-UHFFFAOYSA-N
SMILES:NC=1C=C2C(=NNC2=CC1)C3=CC=C(C#N)C=C3
Synonyms:- Benzonitrile, 4-(5-amino-1H-indazol-3-yl)-
- 4-(5-Amino-1H-indazol-3-yl)benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
