CAS 1356087-76-7
:5-Nitro-3-[2-(trifluoromethyl)phenyl]-1H-indazole
Description:
5-Nitro-3-[2-(trifluoromethyl)phenyl]-1H-indazole is a chemical compound characterized by its complex structure, which includes an indazole core substituted with a nitro group and a trifluoromethylphenyl moiety. The presence of the nitro group typically imparts significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The trifluoromethyl group is known for its electron-withdrawing properties, which can enhance the compound's stability and alter its electronic characteristics, potentially affecting its biological activity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Additionally, its unique structural features may contribute to its solubility and interaction with biological targets. As with many nitro-substituted compounds, care should be taken regarding its handling and potential toxicity. Overall, 5-Nitro-3-[2-(trifluoromethyl)phenyl]-1H-indazole represents a valuable structure for further research in both synthetic and medicinal chemistry.
Formula:C14H8F3N3O2
InChI:InChI=1S/C14H8F3N3O2/c15-14(16,17)11-4-2-1-3-9(11)13-10-7-8(20(21)22)5-6-12(10)18-19-13/h1-7H,(H,18,19)
InChI key:InChIKey=BWFPXOUMSDXNJK-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C=2C=3C(NN2)=CC=C(N(=O)=O)C3)C=CC=C1
Synonyms:- 5-Nitro-3-[2-(trifluoromethyl)phenyl]-1H-indazole
- 1H-Indazole, 5-nitro-3-[2-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
