CAS 1356087-80-3
:3-[4-(Trifluoromethyl)phenyl]-1H-indazol-5-amine
Description:
3-[4-(Trifluoromethyl)phenyl]-1H-indazol-5-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) on the phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound typically exhibits a solid-state at room temperature and may be soluble in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the amine functional group, which can participate in hydrogen bonding and interact with biological targets. The trifluoromethyl group is known to enhance metabolic stability and bioactivity, making such compounds of interest in drug design. Additionally, the compound's unique electronic properties may contribute to its reactivity and interactions in various chemical environments. As with many indazole derivatives, it may also exhibit interesting photophysical properties, making it a candidate for further research in both synthetic and applied chemistry contexts.
Formula:C14H10F3N3
InChI:InChI=1S/C14H10F3N3/c15-14(16,17)9-3-1-8(2-4-9)13-11-7-10(18)5-6-12(11)19-20-13/h1-7H,18H2,(H,19,20)
InChI key:InChIKey=VDYFRTNIZZMSIE-UHFFFAOYSA-N
SMILES:NC=1C=C2C(=NNC2=CC1)C3=CC=C(C(F)(F)F)C=C3
Synonyms:- 1H-Indazol-5-amine, 3-[4-(trifluoromethyl)phenyl]-
- 3-[4-(Trifluoromethyl)phenyl]-1H-indazol-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
