
CAS 1356087-82-5
:5-Nitro-3-(2-pyridinyl)-1H-indazole
Description:
5-Nitro-3-(2-pyridinyl)-1H-indazole is a chemical compound characterized by its unique structure, which includes an indazole core substituted with a nitro group and a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of the nitro group often imparts polar characteristics, influencing solubility and interaction with biological systems. The pyridine moiety can enhance the compound's ability to participate in coordination chemistry and may also affect its pharmacological properties. As a heterocyclic compound, it may exhibit interesting electronic properties, making it a candidate for various applications in medicinal chemistry and material science. Additionally, the compound's stability, reactivity, and potential toxicity would depend on the specific conditions under which it is handled. Overall, 5-Nitro-3-(2-pyridinyl)-1H-indazole represents a class of compounds that can be explored for their synthetic utility and biological significance.
Formula:C12H8N4O2
InChI:InChI=1S/C12H8N4O2/c17-16(18)8-4-5-10-9(7-8)12(15-14-10)11-3-1-2-6-13-11/h1-7H,(H,14,15)
InChI key:InChIKey=SJMBFOIOPBQFIE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(=NNC2=CC1)C3=CC=CC=N3
Synonyms:- 1H-Indazole, 5-nitro-3-(2-pyridinyl)-
- 5-Nitro-3-(2-pyridinyl)-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
