
CAS 1356087-86-9
:3-(6-Fluoro-2-pyridinyl)-5-nitro-1H-indazole
Description:
3-(6-Fluoro-2-pyridinyl)-5-nitro-1H-indazole is a chemical compound characterized by its complex structure, which includes a pyridine ring and an indazole moiety. The presence of a fluorine atom at the 6-position of the pyridine ring and a nitro group at the 5-position of the indazole contributes to its unique chemical properties. This compound is typically classified as a heterocyclic aromatic compound, which may exhibit interesting biological activities due to its structural features. The fluorine substitution can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the nitro group can serve as a potential site for further chemical modifications or reactions. As with many heterocycles, the compound may possess specific solubility characteristics, stability under various conditions, and reactivity patterns that are important for its application in medicinal chemistry or material science. Overall, the combination of these functional groups makes it a subject of interest for research in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H7FN4O2
InChI:InChI=1S/C12H7FN4O2/c13-11-3-1-2-10(14-11)12-8-6-7(17(18)19)4-5-9(8)15-16-12/h1-6H,(H,15,16)
InChI key:InChIKey=OXIICOCQXJFDKC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(=NNC2=CC1)C=3N=C(F)C=CC3
Synonyms:- 1H-Indazole, 3-(6-fluoro-2-pyridinyl)-5-nitro-
- 3-(6-Fluoro-2-pyridinyl)-5-nitro-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
