CymitQuimica logo

CAS 1356087-92-7

:

3-(5-Fluoro-2-pyridinyl)-1H-indazol-5-amine

Description:
3-(5-Fluoro-2-pyridinyl)-1H-indazol-5-amine is a chemical compound characterized by its unique structure, which includes an indazole core substituted with a pyridine ring and a fluorine atom. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its ability to interact with various biological targets. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it of interest in medicinal chemistry. The indazole moiety is known for its role in various pharmacological activities, including anti-cancer and anti-inflammatory effects. Additionally, the compound may exhibit solubility in organic solvents, with varying solubility in water, depending on the specific conditions. Its molecular interactions and reactivity can be influenced by the functional groups present, making it a candidate for further research in drug development and synthesis. Overall, this compound represents a class of molecules that are valuable in the exploration of new therapeutic agents.
Formula:C12H9FN4
InChI:InChI=1S/C12H9FN4/c13-7-1-3-11(15-6-7)12-9-5-8(14)2-4-10(9)16-17-12/h1-6H,14H2,(H,16,17)
InChI key:InChIKey=UDVGIPDNKCUZEQ-UHFFFAOYSA-N
SMILES:NC=1C=C2C(=NNC2=CC1)C3=CC=C(F)C=N3
Synonyms:
  • 1H-Indazol-5-amine, 3-(5-fluoro-2-pyridinyl)-
  • 3-(5-Fluoro-2-pyridinyl)-1H-indazol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.